| Cas No.: | 1191237-69-0 |
| Chemical Name: | (2R,3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-carbonitrile |
| Synonyms: | GS-441524; GS 441524; GS441524; Remdesivir-metabolite, GS-5734-metabolite; GS5734-metabolite; GS 5734-metabolite; |
| SMILES: | C1=C2C(=NC=NN2C(=C1)[C@]3([C@@H]([C@@H]([C@H](O3)CO)O)O)C#N)N |
| Formula: | C12H13N5O4 |
| M.Wt: | 291.1 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Publication: |
| Description: | Remdesivir metabolite.Remdesivir blocks SARS-CoV and MERS-CoV in HAE cells with EC50s of both 74 Nm,and also showed potent activity blocking 2019-nCov(Coronavirus). Remdesivir, also known as GS-5734, is an antiviral drug, and a novel nucleotide analog prodrug. Remdesivir inhibits murine hepatitis virus (MHV) with an EC50 of 30 nM, and blocks SARS-CoV and MERS-CoV in HAE cells with EC50s of both 74 nM in HAE cells after treatment for 24 h. GS-5734 inhibits both epidemic and zoonotic coronaviruses. It was developed by Gilead Sciences as a treatment for filovirus infections such as Ebola virus disease and Marburg virus. |
| In Vivo: | |
| In Vitro: | |
| References: |
| Kinase Assay: | |
| Cell Assay: | |
| Animal Administration: | |
| References: |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|