| Cas No.: | |
| Chemical Name: | Caspase-10 Substrate (Ac-AEVD-pNA) [1mM], Colorimetric |
| Synonyms: | Ac-AEVD-pNA, Caspase-10 Substrate, Colorimetric |
| SMILES: | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)NC1=CC=C([N+](=O)[O-])C=C1)C(C)C |
| Formula: | C₂₅H₃₄N₆O₁₁ |
| M.Wt: | 594.7 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
