| Cas No.: | 81336-71-2 |
| Chemical Name: | [Difluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;tributylazanium |
| Synonyms: | Bis(tributylammonium) difluoromethylenediphosphonate;[Difluoro-[hydroxy(oxido)phosphoryl]methyl]-hydroxyphosphinate;tributylazanium |
| SMILES: | P(C(F)(F)P(=O)([O-])O)(=O)([O-])O.[NH+](CCCC)(CCCC)CCCC.[NH+](CCCC)(CCCC)CCCC |
| Formula: | C25H58F2N2O6P2 |
| M.Wt: | 582.682157039642 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
