| Cas No.: | 143130-94-3 |
| Chemical Name: | (Z)-Azoxystrobin |
| Synonyms: | (Z)-Azoxystrobin R230310 standard;(Z)-Azoxystrobin;MMV021057;(Z)-Methyl 2-(2-((6-(2-cyanophenoxy)pyrimidin-4-yl)oxy)phenyl)-3-methoxyacrylate;METHYL (2Z)-2-(2-{[6-(2-CYANOPHENOXY)PYRIMIDIN-4-YL]OXY}PHENYL)-3-METHOXYACRYLATE |
| SMILES: | O(C1C([H])=C(N=C([H])N=1)OC1=C([H])C([H])=C([H])C([H])=C1C#N)C1=C([H])C([H])=C([H])C([H])=C1/C(=C(\[H])/OC([H])([H])[H])/C(=O)OC([H])([H])[H] |
| Formula: | C22N3O5H17 |
| M.Wt: | 403.3875 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Azoxystrobin is a systemic, broad-spectrum fungicide belonging to the class of methoxyacrylates, which are derived from the naturally-occurring strobilurins. It exerts its fungicidal activity by inhibiting mitochondrial respiration in fungi. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
