| Cas No.: | 915365-57-0 |
| Synonyms: | 3-Quinolinecarbonitrile, 8-chloro-4-[(3-chloro-4-fluorophenyl)amino]-6-[[[1-[2-(hexahydro-1H-azepin-1-yl)ethyl]-1H-1,2,3-triazol-4-yl]methyl]amino]- |
| SMILES: | N#CC1=C(C2=CC(NCC3=CN(CCN4CCCCCC4)N=N3)=CC(Cl)=C2N=C1)NC5=CC=C(F)C(Cl)=C5 |
| Formula: | C27H27Cl2FN8 |
| M.Wt: | 553.4613 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Cot inhibitor-1 is a COT/Tpl2 inhibitor. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
