| Cas No.: | 505057-98-7 |
| Chemical Name: | 2-((4-(furan-2-yl)-6-(trifluoromethyl)pyrimidin-2-yl)thio)-N-(5-methylisoxazol-3-yl)acetamide |
| Synonyms: | Hsp90α inhibitor A17 |
| SMILES: | CC1ON=C(NC(CSC2N=C(C3=CC=CO3)C=C(C(F)(F)F)N=2)=O)C=1 |
| Formula: | C15H11F3N4O3S |
| M.Wt: | 384.333 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent Hsp90α/p23 interaction inhibitor with IC50 of 0.15 uM, more effective than CP-9 in degrading pAkt/total Akt and Raf-1; inhibits Hsp90(α/β)/p23 interactions and degrading Hsp90 client proteins in cell culture, but not in live mice. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
