| Cas No.: | 137945-48-3 |
| Chemical Name: | (6aR,10aR)-1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydro-6H-dibenzo[b,d]pyran-9-carboxylic acid |
| Synonyms: | Ajulemic acid;IP-751;Anabasum |
| SMILES: | CCCCCCC(C)(C)C1C=C2C(=C(O)C=1)[C@H]3[C@@H](CC=C(C(O)=O)C3)C(C)(C)O2 |
| Formula: | C25H36O4 |
| M.Wt: | 400.559 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A synthetic nonpsychoactive cannabinoid acid with potent analgesic and anti-inflammatory activity in vivo, binds directly and selectively to PPARγ; produces significant antitumor activity and effects its actions primarily via CB(2) receptors; inhibits interleukin-8 promoter activity in a PPARgamma-dependent manner; significantly suppresses CYP-induced urinary frequency in rats at 10 mg/kg.FibrosisPhase 2 Clinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
