| Cas No.: | 1598383-41-5 |
| Chemical Name: | Benzamide, N-[(1,2-dihydro-4,6-dimethyl-2-oxo-3-pyridinyl)methyl]-3-[ethyl[trans-4-[(2-methoxyethyl)methylamino]cyclohexyl]amino]-2-methyl-5-[3-(4-morpholinyl)-1-propyn-1-yl]-, 2,2,2-trifluoroacetate (1:x) |
| Synonyms: | EPZ011989 trifluoroacetate |
| SMILES: | CCN(C1CCC(CC1)N(C)CCOC)C2=CC(=CC(=C2C)C(=O)NCC3=C(C=C(NC3=O)C)C)C#CCN4CCOCC4.C(=O)(C(F)(F)F)O |
| Formula: | C37H52F3N5O6 |
| M.Wt: | 719.8339 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, selective, orally bioavailable inhibitor of EZH2 with Ki of < 3 nM; equipotently inhibits mutant and wild-type EZH2, displays >15-fold selectivity over EZH1 and >3000-fold selectivity over other HMTs; demonstrates significant tumor growth inhibition in a mouse xenograft model of human B cell lymphoma.Blood CancerPreclinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
