| Cas No.: | 608-38-8 |
| Chemical Name: | (E)-2,3-Dibromo-2-butenedioic acid |
| SMILES: | O=C(O)/C(Br)=C(Br)/C(O)=O |
| Formula: | C4H2Br2O4 |
| M.Wt: | 273.86 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 608-38-8 |
| Chemical Name: | (E)-2,3-Dibromo-2-butenedioic acid |
| SMILES: | O=C(O)/C(Br)=C(Br)/C(O)=O |
| Formula: | C4H2Br2O4 |
| M.Wt: | 273.86 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |