| Cas No.: | 79484-75-6 |
| Chemical Name: | Eleutheroside D |
| SMILES: | COC1=C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C(OC)=CC([C@H]3OC[C@@]4([H])[C@@]3([H])CO[C@@H]4C5=CC(OC)=C(O[C@H]6[C@@H]([C@H]([C@@H]([C@@H](CO)O6)O)O)O)C(OC)=C5)=C1 |
| Formula: | C34H46O18 |
| M.Wt: | 742.72 |
| Purity: | >98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
