| Cas No.: | 1335202-59-9 |
| Chemical Name: | Febuxostat sec-butoxy acid |
| SMILES: | O=C(C1=C(C)N=C(C2=CC=C(OC(C)CC)C(C#N)=C2)S1)O |
| Formula: | C16H16N2O3S |
| M.Wt: | 316.37 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
