| Cas No.: | 4099-85-8 |
| Chemical Name: | Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside |
| SMILES: | OC[C@@H](O1)[C@@H](O2)[C@@H](OC2(C)C)[C@@H]1OC |
| Formula: | C9H16O5 |
| M.Wt: | 204.22 |
| Sotrage: | 4°C, protect from light, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
