| Cas No.: | 167095-09-2 |
| Chemical Name: | MitoMark Red I |
| SMILES: | ClCC1=CC=C(C(C2=CC3=C4N(CCC3)CCCC4=C2[O+]=C56)=C5C=C7CCCN8CCCC6=C87)C=C1.[Cl-] |
| Formula: | C32H32Cl2N2O |
| M.Wt: | 531.52 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
