| Cas No.: | 915026-99-2 |
| Chemical Name: | Phalloidin-FITC |
| SMILES: | O=C1OC(C(C(O2)=C3)=CC=C3O)(C(C2=C4)=CC=C4O)C(C1=C5)=CC=C5NC(NC[C@](C)(O)C[C@@H](C(N[C@H](C(N[C@]6([H])[C@@H](O)C)=O)C)=O)NC([C@](NC([C@@H](NC([C@@](C[C@@H]7O)([H])N(C7)C8=O)=O)C)=O)([H])CC9=C(SC[C@]8([H])NC6=O)NC%10=CC=CC=C9%10)=O)=S |
| Formula: | C56H60N10O15S2 |
| M.Wt: | 1177.26 |
| Sotrage: | -20°C, sealed storage, away from moisture and light*In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
