To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 73069-27-9 |
| Chemical Name: | (+)-Praeruptorin A |
| Synonyms: | Praeruptorin A;benzo[1,2-b:3,4-b']dipyran-9-ylester, (2Z)-;praeruptorin C;(+)-Praeruptorin A;isopteryxin;(-)-Praeruptorin A;( inverted exclamation markA)-Praeruptorin A;praeruptorin-a;HMS3342I13 |
| SMILES: | O1C2C([H])=C([H])C3C([H])=C([H])C(=O)OC=3C=2C([H])(C([H])(C1(C([H])([H])[H])C([H])([H])[H])OC(C(=C([H])C([H])([H])[H])C([H])([H])[H])=O)OC(C([H])([H])[H])=O |
| Formula: | C21H22O7 |
| M.Wt: | 386.3952 |
| Purity: | >98%, Standard References Grade |
| Sotrage: | 4°C for 1 year, -20°C for more than 2 years |
| Description: | Praeruptorin A is a main bioactive constituent of Peucedanum praeruptorum (also known as Bai-Hua Qian Hu). Praeruptorin A exerts anti-inflammatory effects in vitro through inhibition of NF-κB activation[1]. |
| References: | [1]. Zhou X, et al. Effects of praeruptorin A and praeruptorin C, a racemate isolated from Peucedanum praeruptorum, on MRP2 through the CAR pathway. Planta Med. 2013 Nov;79(17):1641-7. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|