| Cas No.: | |
| Chemical Name: | Seco Rapamycin ethyl ester |
| SMILES: | C[C@H]1[C@@](C(C(N2[C@H](C(OCC)=O)CCCC2)=O)=O)(O)O[C@H](C[C@H](OC)/C(C)=C/C=C/C=C/[C@@H](C)C[C@@H](C)C([C@H](OC)[C@H](O)/C(C)=C/[C@@H](C)C(/C=C/[C@H](C)C[C@@H]3CC[C@@H](O)[C@H](OC)C3)=O)=O)CC1 |
| Formula: | C53H83NO13 |
| M.Wt: | 942.23 |
| Sotrage: | -20°C, protect from light, stored under nitrogen*In solvent : -80°C, 6 months; -20°C, 1 month (protect from light, stored under nitrogen) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
