| Cas No.: | 173550-33-9 |
| Chemical Name: | Compound W |
| Synonyms: | 3,5-Bis(4-nitrophenoxy)benzoic acid |
| SMILES: | O=C(O)C1=CC(OC2=CC=C([N+]([O-])=O)C=C2)=CC(OC3=CC=C([N+]([O-])=O)C=C3)=C1 |
| Formula: | C19H12N2O8 |
| M.Wt: | 396.31 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
