| Cas No.: | 2135304-43-5 |
| Chemical Name: | Herbicidal agent 15 |
| Synonyms: | KHK-IN-2 |
| SMILES: | N#CC1=C(C(F)(F)F)C=C(N2C[C@H](O)[C@@H](O)C2)N=C1N3CC[C@](C)(O)C3 |
| Formula: | C16H19F3N4O3 |
| M.Wt: | 372.34 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
