| Cas No.: | 135-62-6 |
| Chemical Name: | GW-5823 |
| Synonyms: | 2-Naphthalenecarboxamide, 3-hydroxy-N-(2-methoxyphenyl)-; 3-Hydroxy-2'-methoxy-2-naphthanilide; 3-Hydroxy-N-(2-methoxyphenyl)-2-naphthalenecarboxamide; |
| SMILES: | O=C(NC1=CC=CC=C1OC)C2=C(O)C=C3C=CC=CC3=C2 |
| Formula: | C18H15NO3 |
| M.Wt: | 293.32 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
