| Cas No.: | |
| Chemical Name: | N-(4-Isopropylphenyl)-4-(pyrazolo[1,5-b]pyridazin-3-yl)pyrimidin-2-amine |
| Synonyms: | UNC10112785; UNC-10112785; UNC 10112785 |
| SMILES: | CC(C1=CC=C(NC2=NC=CC(C3=C4C=CC=NN4N=C3)=N2)C=C1)C |
| Formula: | C19H18N6 |
| M.Wt: | 330.40 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
