| Cas No.: | |
| Chemical Name: | 4A3-SCC-10 |
| Synonyms: | 4A3SCC10, 4A3 SCC 10 |
| SMILES: | O=C(OCCSSCCOC(C(C)CCSCCCCCCCCCC)=O)CCN(CCCN(C)CCCN(CCC(OCCSSCCOC(C(C)CSCCCCCCCCCC)=O)=O)CCC(OCCSSCCOC(C(C)CSCCCCCCCCCC)=O)=O)CCC(OCCSSCCOC(C(C)CCSCCCCCCCCCC)=O)=O |
| Formula: | C91H171N3O16S12 |
| M.Wt: | 1948.1 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | 1. Ansell, S.M., and Du, X. Lipids and lipid nanoparticle formulations for delivery of nucleic acids. US 10,166,298 B2, (2019). 2. Lin, J.C.P., and Tam, Y. Lipid delivery of therapeutic agents to adipose tissue. (2018). 3. Sahin, U., Lindemann, C., Diekmann, J., et al. RNA compositions targeting claudin-18.2. (2021). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
