| Cas No.: | 2412492-09-0 |
| Chemical Name: | A18-Iso5-2DC18 |
| Synonyms: | 1H -Imidazole-2-carboxylic acid, 1-[3-(2-ethyl-1-piperidinyl)propyl]-5,5-di-(8Z )-8-heptadecen-1-yl-2,5-dihydro-, ethyl ester (ACI);A18ISO52DC18, A18 ISO5 2DC18 |
| SMILES: | C1(N(CCCN2C(C(OCC)=O)N=CC2(CCCCCCC/C=C\CCCCCCCC)CCCCCCC/C=C\CCCCCCCC)CCCC1)CC |
| Formula: | C50H93N3O2 |
| M.Wt: | 768.29 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Miao, L. et al. Delivery of mRNA vaccines with heterocyclic lipids increases anti-tumor efficacy by STING-mediated immune cell activation. Nat. Biotechnol. 37, 1174–1185 (2019) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
