| Cas No.: | 2832061-33-1 |
| Chemical Name: | AA3-DLin |
| Synonyms: | piperazine-1,4-diylbis(ethane-2,1-diyl) (9Z,9'Z,12Z,12'Z)-bis(octadeca-9,12-dienoate);AA3DLin, AA3 DLin |
| SMILES: | O=C(CCCCCCC/C=C\C/C=C\CCCCC)OCCN1CCN(CCOC(CCCCCCC/C=C\C/C=C\CCCCC)=O)CC1 |
| Formula: | C44H78N2O4 |
| M.Wt: | 699.1 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | 1. Li, Z., Zhang, X.-Q., Ho, W., et al. Enzyme-catalyzed one-step synthesis of ionizable cationic lipids for lipid nanoparticle-based mRNA COVID-19 vaccines. ACS Nano 16(11), 18936–18950 (2022). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
