| Cas No.: | |
| Chemical Name: | CF3-2N6-UC18 |
| Synonyms: | CF32N6UC18, CF3 2N6 UC18 |
| SMILES: | CCCCCCCC/C=C\CCCCCCCCN(CCCCCCCC)CCCCCCNC1=CC=NC2=C1C=CC(C(F)(F)F)=C2 |
| Formula: | C53H92F3N3 |
| M.Wt: | 828.34 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Structure-guided design of endosomolytic chloroquine-like lipid nanoparticles for mRNA delivery and genome editing-Nature Communications volume 16, Article number: 4241 (2025) |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
