| Cas No.: | 1247879-16-8 |
| Chemical Name: | (4R)-2-(6,7-Dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| Synonyms: | CycLuc1(Luciferase substrate);(4R)-2-(6,7-Dihydro-5H-pyrrolo[3,2-f][1,3]benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic a;CycLuc1 |
| SMILES: | O=C([C@@H]1N=C(C2=NC3=CC4=C(NCC4)C=C3S2)SC1)O |
| Formula: | C13H11N3O2S2 |
| M.Wt: | 305.3753 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | CycLuc1 is a brain penetrant luciferase substrate. |
| In Vitro: | [1]. Shiv K, et al. Abstract 4112: Synthetic luciferin, CycLuc1, improves bioluminescence imaging for intracranial glioblastoma xenografts. 10.1158/1538-7445.AM2018-4112 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
