Cas No.: | 1345407-05-7 |
Chemical Name: | L-Lysyl-L-lysyl-L-tryptophyl-L-tryptophyl-L-lysyl-L-lysyl-L-tryptophyl-β-phenyl-L-phenylalanyl-L-lysinamide |
Synonyms: | Oncopore |
SMILES: | C1=CC=C(C=C1)C(C2=CC=CC=C2)[C@@H](C(=O)N[C@@H](CCCCN)C(=O)N)NC(=O)[C@H](CC3=CNC4=CC=CC=C43)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CC5=CNC6=CC=CC=C65)NC(=O)[C@H](CC7=CNC8=CC=CC=C87)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)N |
Formula: | C78H106N18O9 |
M.Wt: | 1439.79145669937 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | LTX-315 (Oncopore) is a synthetic 9-mer anticancer peptide that preferentially permeabilizes mitochondrial membranes, thereby causing partially BAX/BAK1-regulated, caspase-independent necrosis; triggers immunogenic cell death, induces cell death and DAMP release by mitochondria distortion in human melanoma cells. |