| Cas No.: | 1398568-47-2 |
| Chemical Name: | Milademetan |
| Synonyms: | Milademetan;DS-3032;L-erythro-Hexonamide, 2,6-anhydro-5-[[[(3'R,4'S,5'R)-6''-chloro-4'-(2-chloro-3-fluoro-4-pyridinyl)-1'',2''-dihydro-4,4-dimethyl-2''-oxodispiro[cyclohexane-1,2'-pyrrolidine-3',3''-[3H]indol]-5'-yl]carbonyl]amino]-3,4,5-trideoxy-;DS-3032B (Milademetan) |
| SMILES: | O=C1NC2=CC(Cl)=CC=C2[C@]21[C@@H](C1=CC=NC(Cl)=C1F)[C@H](C(=O)N[C@H]1CO[C@H](C(=O)N)CC1)NC12CCC(C)(C)CC1 |
| Formula: | C30H34Cl2FN5O4 |
| M.Wt: | 618.526468753815 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DS-3032b is a potent, selective, orally available MDM2-p53 inhibitor with potential antineoplastic activity; binds to, and prevents the binding of MDM2 protein to the transcriptional activation domain of the tumor suppressor protein p53; restores p53 signaling and leads to the p53-mediated induction of tumor cell apoptosis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
