| Cas No.: | 2588111-36-6 |
| Chemical Name: | Lipid 15 |
| Synonyms: | Lipid-15,Lipid 15 ,Lipid15 |
| SMILES: | O=C(OCCN(CCCCCCCC/C=C\C/C=C\CCCCC)CCCCCCCCOC(C(CCCCCCCC)CCCCCC)=O)CCCN(C)C |
| Formula: | C50H96N2O4 |
| M.Wt: | 789.31 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | [1]. Elia U, Ramishetti S, Rosenfeld R, et al. Design of SARS-CoV-2 hFc-Conjugated Receptor-Binding Domain mRNA Vaccine Delivered via Lipid Nanoparticles. ACS Nano. 2021;15(6):9627-9637. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
