| Cas No.: | 2796227-17-1 |
| Chemical Name: | S-Ac7-DOG |
| Synonyms: | S Ac7 DOG;S-Ac7-DOG;EX-A8824;S Ac7 DOG |
| SMILES: | S(CCOC(NCCN1CCCCCC1)=O)SCCOC(NCC(COC(CCCCCCC/C=C\CCCCCCCC)=O)OC(CCCCCCC/C=C\CCCCCCCC)=O)=O |
| Formula: | C53H97N3O8S2 |
| M.Wt: | 968.48 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Lipid nanoparticle composition for adjuvant formulation modulates disease after influenza virus infection in QIV vaccinated mice-https://www.biorxiv.org/content/10.1101/2024.01.14.575599v1 |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
