| Cas No.: | 2430034-17-4 |
| Synonyms: | ((2-hydroxyethyl)azanediyl)bis(octane-8,1-diyl) bis(2-hexyldecanoate).ALC0315 analogous1, ALC 0315 analogous 1 |
| SMILES: | OCCN(CCCCCCCCOC(C(CCCCCC)CCCCCCCC)=O)CCCCCCCCOC(C(CCCCCC)CCCCCCCC)=O |
| Formula: | C50H99NO5 |
| M.Wt: | 794.340 |
| Purity: | >95% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
