To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1005264-47-0 |
| Chemical Name: | MX 69; MX-69 |
| Synonyms: | MX 69; MX-69 |
| SMILES: | O=C(O)C1=CC=C(C2C(CC=C3)C3C(C=C(S(=O)(NC4=CC(C)=C(C)C=C4)=O)C=C5)=C5N2)C=C1 |
| Formula: | C27H26N2O4S |
| M.Wt: | 474.57 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | MX69 is an inhibitor of MDM2/XIAP, used for cancer treatment. |
| In Vivo: | MX69-induced MDM2 downregulation results in activation of p53 which contributes to inhibition of cancer cell proliferation in vivo[1]. |
| In Vitro: | MX69 blocks the MDM2 protein-XIAP RNA interaction, leading to MDM2 degradation. MX69 shows minimal inhibitory effect on normal human hematopoiesis in vitro and is very well tolerated in animal models. MX69-induced MDM2 downregulation results not only in inhibition of XIAP expression, but also in activation of p53, which contributes to cancer cell apoptosis in vitro[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|