To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 1784751-18-3 |
| Chemical Name: | 4-(2-(2,6-Difluorophenyl)-4-(fluorophenyl)-1H-imidazol-5-yl)pyridine |
| Synonyms: | TA-01,TA01，TA 01 |
| SMILES: | C(C1NC(C2=CC=NC=C2)=C(C2=CC=C(F)C=C2)N=1)1=C(F)C=CC=C1F |
| Formula: | C20H12F3N3 |
| M.Wt: | 351.32 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TA-01 is a potent CK1 and p38 MAPK inhibitor, with IC50s of 6.4 nM, 6.8 nM, 6.7 nM for CK1ε, CK1δ and p38 MAPK, respectively. |
| In Vitro: | TA-01 is a potent CK1 and p38 MAPK inhibitor, with IC50s of 6.4 nM, 6.8 nM, 6.7 nM for CK1ε, CK1δ and p38 MAPK, respectively. TA-01 (5 μM) is not cytotoxic, completely inhibits cardiogenesis, but induces cardiogenesis at lower concentration[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|