| Cas No.: | 1349197-90-5 |
| Chemical Name: | di-Pal-MTO |
| Synonyms: | diPalMTO, di Pal MTO |
| SMILES: | CCCCCC/C=C\CCCCCCCC(OCCNCCNC1=C2C(C(C3=C(O)C=CC(O)=C3C2=O)=O)=C(C=C1)NCCNCCOC(CCCCCCC/C=C\CCCCCC)=O)=O |
| Formula: | C54H84N4O8 |
| M.Wt: | 917.27 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
.png)