To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 874755-26-7 |
| Chemical Name: | 7-[[4-Amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one |
| Synonyms: | GPR40/FFAR1 modulator 1;HMS1734E08;7-[[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one;Z18477911;7-({4-amino-6-[(2-methylphenyl)amino]-1,3,5-triazin-2-yl}methoxy)-4-methyl-2H-chromen-2-one |
| SMILES: | O1C(C([H])=C(C([H])([H])[H])C2C([H])=C([H])C(=C([H])C1=2)OC([H])([H])C1=NC(N([H])[H])=NC(=N1)N([H])C1=C([H])C([H])=C([H])C([H])=C1C([H])([H])[H])=O |
| Formula: | C21H19N5O3 |
| M.Wt: | 389.4073 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |