| Cas No.: | |
| Chemical Name: | Lipid GVS-18-B6 |
| Synonyms: | Lipid GVS 18 B6 |
| SMILES: | CCCCC/C=C\CCCO[Si](CCCCN(C)C)(OCCC/C=C\CCCCC)OCCC/C=C\CCCCC |
| Formula: | C36H71NO3Si |
| M.Wt: | 594.528 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Silicon Ether Ionizable Lipids Enable Potent mRNA Lipid Nanoparticles with Rapid Tissue Clearance-ACS Nano-Apr 3, 2024-by Richard HollandKieu, James Heyes |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
