| Cas No.: | 64815-81-2 |
| Chemical Name: | H-D-Phe-Pip-Arg-pNA |
| Synonyms: | {D-Phe}-{Pip}-R-pNA |
| SMILES: | NC(N)=NCCCC(NC(=O)[C@@H]1CCCCN1C(=O)[C@H](N)CC1=CC=CC=C1)C(=O)NC1=CC=C([N+](=O)[O-])C=C1 |
| Formula: | C27H36N8O5 |
| M.Wt: | 552.63 |
| Purity: | 98% |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
