| Cas No.: | 50-55-5 |
| Chemical Name: | methyl (1S,2R,3R,4aS,13bR,14aS)-2,11-dimethoxy-3-((3,4,5-trimethoxybenzoyl)oxy)-1,2,3,4,4a,5,7,8,13,13b,14,14a-dodecahydroindolo[2',3':3,4]pyrido[1,2-b]isoquinoline-1-carboxylate |
| Synonyms: | Reserpine, Reserpine phosphate, Raudixin, Serpalan, Serpasil |
| SMILES: | O=C(OC)[C@H]1[C@@]2([H])C[C@](N(CC3)C[C@@]2([H])C[C@@H](OC(C4=CC(OC)=C(OC)C(OC)=C4)=O)[C@@H]1OC)([H])C5=C3C(C=CC(OC)=C6)=C6N5 |
| Formula: | C33H40N2O9 |
| M.Wt: | 608.688 |
| Purity: | >98% |
| Sotrage: | 4°C for 1 year, -20°C for more than 2 years |
| Description: | Reserpine is an inhibitor of the vesicular monoamine transporter 2 (VMAT2). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
