To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 23142-01-0 |
| SMILES: | CCN(CCOCCOC(C1(C2=CC=CC=C2)CCCC1)=O)CC.OC(CC(C(=O)O)(O)CC(=O)O)=O.OC(CC(C(=O)O)(O)CC(=O)O)=O |
| Formula: | C26H39NO10 |
| M.Wt: | 525.59 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Carbetapentane citrate is a selective inhibitor of the cough, with mild atropine-like effect and local anesthesia effect. |
