| Cas No.: | 2089293-61-6 |
| Chemical Name: | NAcM-OPT |
| Synonyms: | NAcM-OPT;1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,4-dichlorophenyl)urea;N-Benzyl-N-(1-Butylpiperidin-4-Yl)-N'-(3,4-Dichlorophenyl)urea;TQR0768;BDBM50245237;8ZA;CS-0042279;EX-A3517;NAcM-OPT - Bio-X;G16407;HY-111505;BN165240;MS-27774;AKOS037515469;2089293-61-6;AC-36419;SCHEMBL18657584;DA-65911;1-Benzyl-1-(1-butyl-4-piperidinyl)-3-(3,4-dichlorophenyl)urea;CHEMBL4074213;NACM-OPT (1-BenZyl-1-(1-butyl-4-piperidyl)-3-(3,4-dichlorophenyl)urea);MFCD31693837;CHEBI:188786 |
| SMILES: | ClC1=C(C=CC(=C1)NC(N(CC1C=CC=CC=1)C1CCN(CCCC)CC1)=O)Cl |
| Formula: | C23H29Cl2N3O |
| M.Wt: | 434.4018638134 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | In Vitro NAcM-OPT (Compound 67) is orally bioavailable, well tolerated in mice, and currently used to study the effects of acute pharmacologic inhibition of the DCN1-UBE2M interaction on the NEDD8/CUL pathway. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
