| Cas No.: | 1333146-24-9 |
| Chemical Name: | N-methyl-3-(1-(4-(piperazin-1-yl)phenyl)-5-(4'-(trifluoromethyl)-[1,1'-biphenyl]-4-yl)-1H-pyrazol-3-yl)propanamide |
| Synonyms: | OSU-T315 (1,5-isomer) |
| SMILES: | O=C(CCC1C=C(C2C=CC(C3C=CC(C(F)(F)F)=CC=3)=CC=2)N(C2C=CC(N3CCNCC3)=CC=2)N=1)NC |
| Formula: | C30H30F3N5O |
| M.Wt: | 553.6 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | ILK-IN-2 is an inhibitor of integrin-linked kinase (ILK) with an IC50 of 600 nM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
