| Cas No.: | 1903800-11-2 |
| Chemical Name: | 7-((4-(difluoromethoxy)phenyl)((5-methoxybenzo[d]thiazol-2-yl)amino)methyl)quinolin-8-ol |
| Synonyms: | KIN-1408;KIN 1408;7-((4-(difluoromethoxy)phenyl)((5-methoxybenzo[d]thiazol-2-yl)amino)methyl)quinolin-8-ol |
| SMILES: | COC1=CC2=C(C=C1)SC(=N2)NC(C3=CC=C(C=C3)OC(F)F)C4=C(C5=C(C=CC=N5)C=C4)O |
| Formula: | C25H19F2N3O3S |
| M.Wt: | 479.4985 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A small-molecule MAVS-dependent IRF3 agonist that shows antiviral activity against Flaviviridae, Filoviridae (Ebola virus), Orthomyxoviridae (influenza A virus), Arenaviridae (Lassa virus) and Paramyxoviridae (RSVs, Nipah virus); induces relocalization of pTBK1 from centrosomes to mitochondria, and increases CASP3-mediated cell death; the RIG-I-like receptor (RLR) agonist. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
