| Cas No.: | 117279-73-9 |
| Chemical Name: | 4-(2-chlorophenyl)-2-(4-isobutylphenethyl)-6,9-dimethyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine |
| Synonyms: | Y-24180;Y24180;Y 24180 |
| SMILES: | CC1C2=NN=C(N2C3=C(C=C(S3)CCC4=CC=C(C=C4)CC(C)C)C(=N1)C5=CC=CC=C5Cl)C |
| Formula: | C28H29ClN4S |
| M.Wt: | 489.074 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks4°C in DMSO,6 months-80°C in DMSO |
| Publication: | 1. Takehara S, et al. Prostaglandins. 1990 Dec;40(6):571-83. 2. Kagoshima M, et al. Pharmacology. 1997 May;54(5):261-70. 3. Yamaguchi S, et al. Inflamm Res. 2000 Nov;49(11):584-90. |
| Description: | Israpafant (Y24180) is a specific antagonist of PAF receptor that inhibits PAF-induced rabbit platelet aggregation in vitro (IC50=3.84 nM), with little effect on adenosine diphosphate- or arachidonic acid-induced aggregation. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
