| Cas No.: | 1241902-40-8 |
| Chemical Name: | (4-(4-propylcyclohexyl)benzoyl)-L-valine |
| Synonyms: | GNE0439 |
| SMILES: | CCCC1CCC(CC1)C2=CC=C(C=C2)C(=O)N[C@@H](C(C)C)C(=O)O |
| Formula: | C21H31NO3 |
| M.Wt: | 345.483 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GNE-0439 is a novel potent, selective inhibitor of Nav1.7 channel with IC50 of 0.34 uM, shows high selectivity over Nav1.5 (IC50=38.3 uM); also inhibits mutant N1742K channels with IC50 of 0.37 uM in membrane potential assays, but not mutation of R1608A (IC50>50 uM), and is unique compared with known selective VSD4 binders such as the arylsulfonamides (GX-936 and PF-05089771). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
