| Cas No.: | 2070015-00-6 |
| Chemical Name: | Methanone, [4-[[4-(ethylamino)-5-(trifluoromethyl)-2-pyrimidinyl]amino]-2-fluoro-5-methoxyphenyl]-4-morpholinyl-, 4-methylbenzenesulfonate (1:1) |
| Synonyms: | GNE7915 tosylate;GNE 7915 tosylate |
| SMILES: | CCNC1=NC(=NC=C1C(F)(F)F)NC2=C(C=C(C(=C2)F)C(=O)N3CCOCC3)OC.CC1=CC=C(C=C1)S(=O)(=O)O |
| Formula: | C26H29F4N5O6S |
| M.Wt: | 615.597 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GNE-7915 tosylate (GNE7915 tosylate) is a highly potent, selective, and brain-penetrable LRRK2 inhibitor with IC50 of 1.9 nM; shows 1/187 kinases with 50% inhibition at 0.1 uM; possesses an ideal balance of LRRK2 cellular potency, broad kinase selectivity, metabolic stability, and brain penetration across multiple species. Parkinson's Disease Preclinical |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
