| Cas No.: | 252557-97-4 |
| Chemical Name: | L-Phenylalanine, N-[(phenylmethoxy)carbonyl]-L-isoleucyl-L-α-glutamyl-L-prolyl-, 4-methyl ester |
| Synonyms: | Z-Ile-Glu-Pro-Phe-CO2Me |
| SMILES: | CC[C@H](C)[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)OC)NC(=O)OCC3=CC=CC=C3 |
| Formula: | C34H44N4O9 |
| M.Wt: | 652.7346 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | A potent, peptide-inhibitor of human chymase with Ki of 1 nM; causes an almost complete inhibition of the AI-induced contractions combined with Enalaprilat; depresses the (Pro11-,D-Ala12)-AI-induced contractions at 10 uM. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
