| Cas No.: | 1051375-13-3 |
| Chemical Name: | Cabotegravir Sodium |
| Synonyms: | Cabotegravir Sodium;GSK1265744 (sodiuM salt);(3S,11AR)-N-(2,4-DIFLUOROBENZYL)-6-HYDROXY-3-METHYL-5,7-DIOXO-2,3,5,7,11,11A-HEXAHYDROOXAZOLO[3,2-A]PYRIDO[1,2-D]PYRAZINE-8-CARBOXAMIDE, SODIUM SALT |
| SMILES: | [Na+].FC1C=C(F)C(=CC=1)CNC(=O)C2C(=O)C([O-])=C3N(C=2)C[C@@H]4N([C@@H](C)CO4)C3=O |
| Formula: | C19H16N3O5F2-.Na+ |
| M.Wt: | 427.33404 |
| Description: | Cabotegravir, also known as S/GSK1265744 or GSK744, is potent HIV integrase inhibitor under development for the treatment of HIV infection. Cabotegravir has a carbamoyl pyridone structure similar to dolutegravir. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
