| Cas No.: | 17608-47-8 |
| Chemical Name: | 5alpha-Cholest-7-en-3beta-ol |
| Synonyms: | 5alpha-Cholest-7-en-3beta-ol;Cholesta-7,24-dien-3beta-ol;Delta7,24-Cholestadien-3beta-ol;5-alpha-cholesta-7,24-dien-3-beta-ol;(3beta,5alpha)-cholesta-7,24-dien-3-ol;5alpha-Cholesta-7,24-dien-3beta-ol;cholesta-7,24-dien-3-ol |
| SMILES: | C[C@@H]([C@@H]1[C@@]2([C@H](C3[C@H](CC2)[C@@]2(C(C[C@H](CC2)O)CC=3)C)CC1)C)CC/C=C(\C)/C |
| Formula: | C27H44O |
| M.Wt: | 384.637668609619 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
