To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 54201-67-1 |
| Chemical Name: | 7-p-Toluenesulfonylhydrazide Cholesterol 3-Acetate |
| Synonyms: | 7-p-Toluenesulfonylhydrazide Cholesterol 3-Acetate;7-p-Toluenesulfonylh;[(3R,7E,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-[(4-methylphenyl)sulfonylhydrazinylidene]-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate;(3alpha,7E,8xi)-7-[2-(4-Methylbenzene-1-sulfonyl)hydrazinylidene]cholest-5-en-3-yl acetate;54201-67-1 |
| SMILES: | S(C1C=CC(C)=CC=1)(N/N=C1/C=C2C[C@@H](CC[C@]2(C)[C@H]2CC[C@]3(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]3C2/1)OC(C)=O)(=O)=O |
| Formula: | C36H54N2O4S |
| M.Wt: | 610.889969348907 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |