| Cas No.: | 17137-70-1 |
| Chemical Name: | Cholest-7-en-3-ol,acetate, (3b)- (9CI) |
| Synonyms: | Cholest-7-en-3-ol,acetate, (3b)- (9CI);[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;Cholest-7-en-3β-ol acetate;[(3S,5S,9R,10S,13R,14R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate;AC1L7MJX;NSC226098;NSC-226098 |
| SMILES: | CC(CCCC(C1CCC2C3=CCC4CC(CCC4(C)C3CCC12C)OC(=O)C)C)C |
| Formula: | C29H48O2 |
| M.Wt: | 428.69022 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
