| Cas No.: | 2665-04-5 |
| Chemical Name: | DESMOSTEROL ACETATE |
| Synonyms: | DESMOSTEROL ACETATE;Cholesta-5,24-dien-3β-ol, acetate;Cholesta-5,24-dien-3β-yl acetate;Desmosterol acetate;Desmosteryl acetate |
| SMILES: | C/C(/C)=C\CCC(C)[C@@H]1[C@]2(CC[C@@H]3[C@]4(CC[C@H](OC(C)=O)CC4=CC[C@H]3[C@@H]2CC1)C)C |
| Formula: | C29H46O2 |
| M.Wt: | 426.67400 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
